Other Solvents
Filtered Search Results
Ethyl Ether, Anhydrous, ACS, 99%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 60-29-7 Molecular Weight (g/mol): 74.12
| CAS | 60-29-7 |
|---|---|
| Molecular Weight (g/mol) | 74.12 |
2,2,4-Trimethylpentane, 99+%, ACS reagent
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.232 MDL Number: MFCD00008943 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane PubChem CID: 10907 ChEBI: CHEBI:62805 IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| PubChem CID | 10907 |
|---|---|
| CAS | 540-84-1 |
| Molecular Weight (g/mol) | 114.232 |
| ChEBI | CHEBI:62805 |
| MDL Number | MFCD00008943 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
Toluene-d8, for NMR, 99.5 atom % D, AcroSeal™
CAS: 2037-26-5 Molecular Formula: C7H8 Molecular Weight (g/mol): 100.19 InChI Key: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene SMILES: CC1=CC=CC=C1
| PubChem CID | 74861 |
|---|---|
| CAS | 2037-26-5 |
| Molecular Weight (g/mol) | 100.19 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene |
| InChI Key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molecular Formula | C7H8 |
2,2,4-Trimethylpentane, CHROMASOLV™ Plus, for HPLC,≥99.5%, Solstice
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.23 MDL Number: MFCD00008943 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: Isooctane IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| CAS | 540-84-1 |
|---|---|
| Molecular Weight (g/mol) | 114.23 |
| MDL Number | MFCD00008943 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | Isooctane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
Dichloromethane-d2, for NMR, packaged in 0.75 ml ampoules, 99.8 atom % D
CAS: 1665-00-5 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 86.939 MDL Number: MFCD00000882 InChI Key: YMWUJEATGCHHMB-DICFDUPASA-N Synonym: dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d PubChem CID: 160586 IUPAC Name: dichloro(dideuterio)methane SMILES: C(Cl)Cl
| PubChem CID | 160586 |
|---|---|
| CAS | 1665-00-5 |
| Molecular Weight (g/mol) | 86.939 |
| MDL Number | MFCD00000882 |
| SMILES | C(Cl)Cl |
| Synonym | dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d |
| IUPAC Name | dichloro(dideuterio)methane |
| InChI Key | YMWUJEATGCHHMB-DICFDUPASA-N |
| Molecular Formula | CH2Cl2 |
Deuterium chloride, for NMR, 20 wt. % solution in D2O, 100.0 atom % D
CAS: 7698-05-7 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00044642 InChI Key: VEXZGXHMUGYJMC-FTGQXOHASA-N Synonym: deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide PubChem CID: 522634 SMILES: Cl
| PubChem CID | 522634 |
|---|---|
| CAS | 7698-05-7 |
| Molecular Weight (g/mol) | 36.46 |
| MDL Number | MFCD00044642 |
| SMILES | Cl |
| Synonym | deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide |
| InChI Key | VEXZGXHMUGYJMC-FTGQXOHASA-N |
| Molecular Formula | ClH |
Pyridine-d5, for NMR, with 0.03% TMS, 100.0 atom% D
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |
1,1,2,2-Tetrachloroethane-d{2}, 99.5% (Isotopic)
CAS: 33685-54-0 Molecular Formula: C2H2Cl4 Molecular Weight (g/mol): 169.85 MDL Number: MFCD00037672 InChI Key: QPFMBZIOSGYJDE-QDNHWIQGSA-N Synonym: 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d PubChem CID: 118531 IUPAC Name: 1,1,2,2-tetrachloro-1,2-dideuterioethane SMILES: C(C(Cl)Cl)(Cl)Cl
| PubChem CID | 118531 |
|---|---|
| CAS | 33685-54-0 |
| Molecular Weight (g/mol) | 169.85 |
| MDL Number | MFCD00037672 |
| SMILES | C(C(Cl)Cl)(Cl)Cl |
| Synonym | 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d |
| IUPAC Name | 1,1,2,2-tetrachloro-1,2-dideuterioethane |
| InChI Key | QPFMBZIOSGYJDE-QDNHWIQGSA-N |
| Molecular Formula | C2H2Cl4 |
Chloroform-d, for NMR, 99.8+% D, stab. with Ag foil, 0.02-0.04 v/v% TMS
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Trifluoroacetic acid-d, for NMR, 99 atom % D
CAS: 599-00-8 Molecular Formula: C2HF3O2 Molecular Weight (g/mol): 115.029 MDL Number: MFCD00044563 InChI Key: DTQVDTLACAAQTR-DYCDLGHISA-N PubChem CID: 71502 IUPAC Name: deuterio 2,2,2-trifluoroacetate SMILES: C(=O)(C(F)(F)F)O
| PubChem CID | 71502 |
|---|---|
| CAS | 599-00-8 |
| Molecular Weight (g/mol) | 115.029 |
| MDL Number | MFCD00044563 |
| SMILES | C(=O)(C(F)(F)F)O |
| IUPAC Name | deuterio 2,2,2-trifluoroacetate |
| InChI Key | DTQVDTLACAAQTR-DYCDLGHISA-N |
| Molecular Formula | C2HF3O2 |
Acetic acid-d, for NMR, 98 atom % D
CAS: 758-12-3 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 61.058 MDL Number: MFCD00051050 InChI Key: QTBSBXVTEAMEQO-DYCDLGHISA-N Synonym: acetic acid-d,acetic acid-d1,monodeuteroacetic acid,acetic 2h acid,acetic acid-od,o-2h acetic acid,mono-deuteroacetic acid,ch3cood PubChem CID: 2723902 IUPAC Name: deuterio acetate SMILES: CC(=O)O
| PubChem CID | 2723902 |
|---|---|
| CAS | 758-12-3 |
| Molecular Weight (g/mol) | 61.058 |
| MDL Number | MFCD00051050 |
| SMILES | CC(=O)O |
| Synonym | acetic acid-d,acetic acid-d1,monodeuteroacetic acid,acetic 2h acid,acetic acid-od,o-2h acetic acid,mono-deuteroacetic acid,ch3cood |
| IUPAC Name | deuterio acetate |
| InChI Key | QTBSBXVTEAMEQO-DYCDLGHISA-N |
| Molecular Formula | C2H4O2 |
2-Bromo-m-xylene, 98+%
CAS: 576-22-7 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.064 MDL Number: MFCD00000075 InChI Key: MYMYVYZLMUEVED-UHFFFAOYSA-N Synonym: 2,6-dimethylbromobenzene,2-bromo-m-xylene,1-bromo-2,6-dimethylbenzene,benzene, 2-bromo-1,3-dimethyl,2,6-dimethyl bromobenzene,m-xylene, 2-bromo,2,6-dimethylphenyl bromide,2-bromo-meta-xylene,2-bromo-1,3-dimethyl-benzene,pubchem3206 PubChem CID: 68471 IUPAC Name: 2-bromo-1,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)C)Br
| PubChem CID | 68471 |
|---|---|
| CAS | 576-22-7 |
| Molecular Weight (g/mol) | 185.064 |
| MDL Number | MFCD00000075 |
| SMILES | CC1=C(C(=CC=C1)C)Br |
| Synonym | 2,6-dimethylbromobenzene,2-bromo-m-xylene,1-bromo-2,6-dimethylbenzene,benzene, 2-bromo-1,3-dimethyl,2,6-dimethyl bromobenzene,m-xylene, 2-bromo,2,6-dimethylphenyl bromide,2-bromo-meta-xylene,2-bromo-1,3-dimethyl-benzene,pubchem3206 |
| IUPAC Name | 2-bromo-1,3-dimethylbenzene |
| InChI Key | MYMYVYZLMUEVED-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
Thermo Scientific Chemicals Gemfibrozil, 98%
CAS: 25812-30-0 Molecular Formula: C15H22O3 Molecular Weight (g/mol): 250.34 MDL Number: MFCD00079335 InChI Key: HEMJJKBWTPKOJG-UHFFFAOYSA-N Synonym: gemfibrozil,lopid,5-2,5-dimethylphenoxy-2,2-dimethylpentanoic acid,jezil,decrelip,lipur,bolutol,apo-gemfibrozil,gemfibromax,cholespid PubChem CID: 3463 ChEBI: CHEBI:5296 IUPAC Name: 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid SMILES: CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1
| PubChem CID | 3463 |
|---|---|
| CAS | 25812-30-0 |
| Molecular Weight (g/mol) | 250.34 |
| ChEBI | CHEBI:5296 |
| MDL Number | MFCD00079335 |
| SMILES | CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1 |
| Synonym | gemfibrozil,lopid,5-2,5-dimethylphenoxy-2,2-dimethylpentanoic acid,jezil,decrelip,lipur,bolutol,apo-gemfibrozil,gemfibromax,cholespid |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid |
| InChI Key | HEMJJKBWTPKOJG-UHFFFAOYSA-N |
| Molecular Formula | C15H22O3 |
3,3',4,4'-Tetramethylbiphenyl, 98%
CAS: 4920-95-0 Molecular Formula: C16H18 Molecular Weight (g/mol): 210.32 MDL Number: MFCD00130219 InChI Key: YXBIAYXZUDJVEB-UHFFFAOYSA-N Synonym: 3,3',4,4'-tetramethylbiphenyl,3,3',4,4'-tetramethyl-1,1'-biphenyl,3,4,3',4'-tetramethylbiphenyl,1,1'-biphenyl, 3,3',4,4'-tetramethyl,biphenyl, 3,3',4,4'-tetramethyl,3,3',4,4'-tetramethyldiphenyl,4-3,4-dimethylphenyl-1,2-dimethylbenzene,acmc-20anh7,amtda180,4-05-00-01956 beilstein handbook reference PubChem CID: 21029 IUPAC Name: 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene SMILES: CC1=CC=C(C=C1C)C1=CC=C(C)C(C)=C1
| PubChem CID | 21029 |
|---|---|
| CAS | 4920-95-0 |
| Molecular Weight (g/mol) | 210.32 |
| MDL Number | MFCD00130219 |
| SMILES | CC1=CC=C(C=C1C)C1=CC=C(C)C(C)=C1 |
| Synonym | 3,3',4,4'-tetramethylbiphenyl,3,3',4,4'-tetramethyl-1,1'-biphenyl,3,4,3',4'-tetramethylbiphenyl,1,1'-biphenyl, 3,3',4,4'-tetramethyl,biphenyl, 3,3',4,4'-tetramethyl,3,3',4,4'-tetramethyldiphenyl,4-3,4-dimethylphenyl-1,2-dimethylbenzene,acmc-20anh7,amtda180,4-05-00-01956 beilstein handbook reference |
| IUPAC Name | 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene |
| InChI Key | YXBIAYXZUDJVEB-UHFFFAOYSA-N |
| Molecular Formula | C16H18 |